| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0767
|
| SigMol name: | N-(7-methyloctanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | isoC9-HSL |
| IUPAC name: | 7-methyl-N-[(3S)-2-oxooxolan-3-yl]octanamide |
| SMILES: | CC(C)CCCCCC(=O)N[C@H]1CCOC1=O |
| Molecular Formula: | C13H23NO3 |
| Molecular Weight (g/mol): | 241.17 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(7-methyloctanoyl)homoserine lactone
|
|
Synthase gene: | acuI
|
|
Recipient gene: | acuR
|
|
Organism: | Aeromonas culicicola [Link to taxonomy browser] |
|
Strain: | MTCC 3249T
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Escherichia coliMT102 (pJBA132) ; and Pseudomonas putida F117 (pRK-C12)
|
|
Identification assay: | GC-MS
|
|
Application: | virulence factor production
|
|
Features of bacteria: | Proteobacteria
|
|
Reference: | 19533714 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.