| |
---|
Chemical Information |
QSSM_ID: | QSSM_0760
|
SigMol name: | N-(3-Hydroxydodecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OHC12-HSL |
IUPAC name: | 3-Hydroxy-N-(2-oxotetrahydro-3-furanyl)dodecanamide |
SMILES: | CCCCCCCCCC(CC(=O)N[C@H]1CCOC1=O)O |
Molecular Formula: | C16H29NO4 |
Molecular Weight (g/mol): | 299.41 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 3-hydroxy-C12-AHL
|
Synthase gene: | afeI
|
Recipient gene: | afeR
|
Organism: | Acidithiobacillus ferrooxidans [Link to taxonomy browser] |
Strain: | ATCC 23270
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL4(pZLR4)
|
Identification assay: | LC-MS/MS
|
Application: | establishment and maintainance of biofilms
|
Features of bacteria: | acidophilic proteobacterium
|
Reference: | 16269739 [Link to PubMed]
|