| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0749
|
| SigMol name: | N-(3-Oxoheptanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC7-HSL |
| IUPAC name: | 3-Oxo-N-(2-oxotetrahydro-3-furanyl)heptanamide |
| SMILES: | O=C1OCCC1NC(=O)CC(=O)CCCC |
| Molecular Formula: | C11H17NO4 |
| Molecular Weight (g/mol): | 227.12 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | 3-oxo-C7-HSL
|
|
Synthase gene: | ytbI
|
|
Recipient gene: | ytbR
|
|
Organism: | Yersinia pseudotuberculosis [Link to taxonomy browser] |
|
Strain: | ypsI mutant
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Chromobacterium violaceum CV026
|
|
Identification assay: | LC-QqQLIT
|
|
Application: | cell-cell contact and flagellar-mediated motility
|
|
Features of bacteria: | human pathogen
|
|
Reference: | 16967185 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.