| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0715
|
| SigMol name: | N-Octadec-11-enoyl-L-Homoserine lactone [Link]
|
| Abbreviation: | C18:1-HSL |
| IUPAC name: | (9Z)-N-[(3S)-2-Oxotetrahydro-3-furanyl]-9-octadecenamide |
| SMILES: | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H]1CCOC1=O |
| Molecular Formula: | C22H39NO3 |
| Molecular Weight (g/mol): | 365.29 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | C18-en-HSL
|
|
Synthase gene: | Not Specified
|
|
Recipient gene: | Not Specified
|
|
Organism: | Roseobacter gallaeciencis [Link to taxonomy browser] |
|
Strain: | T5
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Pseudomonas putida F117 (pRK-C12)
|
|
Identification assay: | GC-MS
|
|
Application: | regulation of symbiotic interaction with host
|
|
Features of bacteria: | marine bacteria
|
|
Reference: | 16283687 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.