| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0619
|
| SigMol name: | N-Isovaleryl-L-homoserine lactone [Link]
|
| Abbreviation: | IV-HSL |
| IUPAC name: | 3-Methyl-N-[(3S)-2-oxotetrahydro-3-furanyl]butanamide |
| SMILES: | CC(C)CC(=O)N[C@H]1CCOC1=O |
| Molecular Formula: | C9H15NO3 |
| Molecular Weight (g/mol): | 185.11 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | isovaleryl-HSL
|
|
Synthase gene: | bjaI
|
|
Recipient gene: | bjaR
|
|
Organism: | Bradyrhizobium japonicum [Link to taxonomy browser] |
|
Strain: | USDA110
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Bradyrhizobium japonicum bjaI-lacZ reporter strain AL05 and bjaI deletion strain AL17
|
|
Identification assay: | HPLC
|
|
Application: | motility, exopolysaccharide synthesis, plasmid transfer, root nodulation efficiencies, and nitrogen-fixation efficiencies
|
|
Features of bacteria: | soyabean symbiont
|
|
Reference: | 21949379 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.