| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0606
|
| SigMol name: | N-Homoadipyl-L-homoserine lactone [Link]
|
| Abbreviation: | HOOCC7-HSL |
| IUPAC name: | 6-{[(2-oxooxolan-3-yl)methyl]carbamoyl}hexanoic acid |
| SMILES: | OC(=O)CCCCCC(=O)NCC1CCOC1=O |
| Molecular Formula: | C12H19NO5 |
| Molecular Weight (g/mol): | 257.13 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | 6-carboxy- HHL
|
|
Synthase gene: | acuI
|
|
Recipient gene: | acuR
|
|
Organism: | Aeromonas veronii [Link to taxonomy browser] |
|
Strain: | MTCC 3249
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Chromobacterium violaceum CV026, Escherichia coli JM109 containing pSB401 and pSB403 and pJBA89
|
|
Identification assay: | HPLC-MS/MS
|
|
Application: | virulence
|
|
Features of bacteria: | disease-causing pathogens of fish and other cold-blooded species, as well as humans
|
|
Reference: | 22666003 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.