| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0582
|
| SigMol name: | N-(3-Oxodecanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC10-HSL |
| IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]decanamide |
| SMILES: | CCCCCCCC(=O)CC(=O)NC1CCOC1=O |
| Molecular Formula: | C14H23NO4 |
| Molecular Weight (g/mol): | 269.34 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-oxodecanoyl)-L-homoserine lactone
|
|
Synthase gene: | luxI homologue
|
|
Recipient gene: | luxR homologue
|
|
Organism: | Bradyrhizobium sp [Link to taxonomy browser] |
|
Strain: | Not Specified
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NT1 (pZLR4), Chromobacterium violaceum CV026
|
|
Identification assay: | HPLC-MS/MS
|
|
Application: | survival and nodulation, including motility, biofilm formation, and cell aggregation
|
|
Features of bacteria: | Peanut-Nodulating bacteria
|
|
Reference: | 22736981 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.