| |
---|
Chemical Information |
QSSM_ID: | QSSM_0575
|
SigMol name: | N-(3-Hydroxytetradec-9-enoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OHC14:1-HSL |
IUPAC name: | (7Z)-3-Hydroxy-N-[(3S)-2-oxotetrahydro-3-furanyl]-7-tetradecenamide |
SMILES: | CCCCCC/C=C\CCCC(CC(=O)N[C@H]1CCOC1=O)O |
Molecular Formula: | C18H31NO4 |
Molecular Weight (g/mol): | 325.23 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 3-OH-C14:1-HSL
|
Synthase gene: | ssbI
|
Recipient gene: | ssbR
|
Organism: | Ruegeria pomeroyi [Link to taxonomy browser] |
Strain: | KLH11
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL4
|
Identification assay: | LC-MS/MS
|
Application: | swimming motility, flagellar motility functions and biofilm formation
|
Features of bacteria: | sponge pathogen
|
Reference: | 22742196 [Link to PubMed]
|