| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0574
|
| SigMol name: | N-(3-Hydroxyhexadec-9-enoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OHC16:1-HSL |
| IUPAC name: | (9E)-3-hydroxy-N-(2-oxooxolan-3-yl)hexadec-9-enamide |
| SMILES: | CCCCCC\C=C\CCCCCC(O)CC(=O)NC1CCOC1=O |
| Molecular Formula: | C20H35NO4 |
| Molecular Weight (g/mol): | 353.26 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | 3-OH-C16:1-HSL
|
|
Synthase gene: | ssaI
|
|
Recipient gene: | ssaR
|
|
Organism: | Ruegeria pomeroyi [Link to taxonomy browser] |
|
Strain: | KLH11
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL4
|
|
Identification assay: | LC-MS/MS
|
|
Application: | swimming motility, flagellar motility functions and biofilm formation
|
|
Features of bacteria: | sponge pathogen
|
|
Reference: | 22742196 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.