| |
Chemical Information |
QSSM_ID: | QSSM_0524
|
SigMol name: | N-(3-hydroxyoctanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OHC8-HSL |
IUPAC name: | 3-Hydroxy-N-(2-oxotetrahydro-3-furanyl)octanamide |
SMILES: | O=C1OCCC1NC(=O)CC(O)CCCCC |
Molecular Formula: | C12H21NO4 |
Molecular Weight (g/mol): | 243.3 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-(3-hydroxyoctanoyl)-L-homoserine lactone
|
Synthase gene: | bmaI
|
Recipient gene: | bmaR
|
Organism: | Burkholderia mallei [Link to taxonomy browser] |
Strain: | RJ23
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL4
|
Identification assay: | MS-MS
|
Application: | biosynthesis of virulence factors
|
Features of bacteria: | etiologic agent of glanders, a gram-negative, oxidase-positive, nonmotile bacillus that is an obligate animal pathogen
|
Reference: | 15501791 [Link to PubMed]
|