| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0482
|
| SigMol name: | N-(3-Hydroxyoctanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OHC8-HSL |
| IUPAC name: | 3-Hydroxy-N-(2-oxotetrahydro-3-furanyl)octanamide |
| SMILES: | O=C1OCCC1NC(=O)CC(O)CCCCC |
| Molecular Formula: | C12H21NO4 |
| Molecular Weight (g/mol): | 243.3 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-hydroxy-octanoyl)homoserine lactone
|
|
Synthase gene: | bpsI3
|
|
Recipient gene: | bpsR3
|
|
Organism: | Burkholderia pseudomallei [Link to taxonomy browser] |
|
Strain: | KHW
|
|
Preliminary assay: | beta-Galactosidase assays
|
|
Bacterial strain used in Preliminary assay: | Escherichia coli DH5_/pRI9-lacZ, DH5_/pR2I29-lacZ and DH5_/pR3I9-lacZ
|
|
Identification assay: | HPLC-MS/MS
|
|
Application: | biofilm formation
|
|
Features of bacteria: | Gram-negative soil bacillus and causative agent of melioidosis
|
|
Reference: | 21252275 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.