| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0421
|
| SigMol name: | N-(3-Oxodecanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC10-HSL |
| IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]decanamide |
| SMILES: | CCCCCCCC(=O)CC(=O)NC1CCOC1=O |
| Molecular Formula: | C14H23NO4 |
| Molecular Weight (g/mol): | 269.34 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-oxodecanoyl)-homoserine lactone
|
|
Synthase gene: | cepI
|
|
Recipient gene: | cepR
|
|
Organism: | Burkholderia vietnamiensis [Link to taxonomy browser] |
|
Strain: | R-921
|
|
Preliminary assay: | AHL assay (horizontal streak)
|
|
Bacterial strain used in Preliminary assay: | Escherichia coli MT102 (pSB403), Escherichia coli MT102 (pSB1075) and Chromobacterium violaceum CV026
|
|
Identification assay: | LC-MS
|
|
Application: | lipase and siderophore production
|
|
Features of bacteria: | opportunistic pathogen
|
|
Reference: | 11403388 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.