| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0368
|
| SigMol name: | N-(3-Oxohexadec-9-enoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC16:1-HSL |
| IUPAC name: | (9Z)-3-Oxo-N-[(3S)-2-oxotetrahydro-3-furanyl]-9-hexadecenamide |
| SMILES: | CCCCCC/C=C\CCCCCC(=O)CC(=O)N[C@H]1CCOC1=O |
| Molecular Formula: | C20H33NO4 |
| Molecular Weight (g/mol): | 351.48 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | 3-oxo-N-(tetrahydro-2-oxo-3-furanyl)-hexadecenamide
|
|
Synthase gene: | sinI
|
|
Recipient gene: | sinR
|
|
Organism: | Sinorhizobium meliloti [Link to taxonomy browser] |
|
Strain: | 1021
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Escherichia coli plasRI_::luxCDABE
|
|
Identification assay: | HPLC-MS/MS
|
|
Application: | exopolysaccharide (EPS) II production and nitrogen fixation
|
|
Features of bacteria: | symbiotic N2 fixation bacterium
|
|
Reference: | 14593447 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.