| |
---|
Chemical Information |
QSSM_ID: | QSSM_0339
|
SigMol name: | N-(3-Oxooctanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC8-HSL |
IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]octanamide |
SMILES: | CCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C12H19NO4 |
Molecular Weight (g/mol): | 241.28 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-3-oxo-octanoyl-homoserine-lactone
|
Synthase gene: | alpI
|
Recipient gene: | alpR
|
Organism: | Azospirillum lipoferum [Link to taxonomy browser] |
Strain: | B518
|
Preliminary assay: | AHL bioassay (cross streaking)
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL1 (pZLR4); Chromobacterium violaceum CV033
|
Identification assay: | LC-MS/MS
|
Application: | virulence factors synthesis for plant-bacterial interaction
|
Features of bacteria: | plant growth-promoting rhizobacteria
|
Reference: | 17064258 [Link to PubMed]
|