| |
---|
Chemical Information |
QSSM_ID: | QSSM_0335
|
SigMol name: | N-(3-hydroxydecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OHC10-HSL |
IUPAC name: | 3-Hydroxy-N-(2-oxotetrahydro-3-furanyl)decanamide |
SMILES: | O=C1OCCC1NC(=O)CC(O)CCCCCCC |
Molecular Formula: | C14H25NO4 |
Molecular Weight (g/mol): | 271.35 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-3-hydroxy-decanoyl-homoserine-lactone
|
Synthase gene: | alpI
|
Recipient gene: | alpR
|
Organism: | Azospirillum lipoferum [Link to taxonomy browser] |
Strain: | TVV3
|
Preliminary assay: | AHL bioassay (cross streaking)
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL1 (pZLR4); Chromobacterium violaceum CV029
|
Identification assay: | LC-MS/MS
|
Application: | virulence factors synthesis for plant-bacterial interaction
|
Features of bacteria: | plant growth-promoting rhizobacteria
|
Reference: | 17064258 [Link to PubMed]
|