| |
---|
Chemical Information |
QSSM_ID: | QSSM_0303
|
SigMol name: | N-(3-Oxooctanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC8-HSL |
IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]octanamide |
SMILES: | CCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C12H19NO4 |
Molecular Weight (g/mol): | 241.28 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-(3-oxooctanoyl)-L-homoserine lactone
|
Synthase gene: | yruI
|
Recipient gene: | yruR
|
Organism: | Yersinia ruckeri [Link to taxonomy browser] |
Strain: | 88
|
Preliminary assay: | well-diffusion assay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NT1 (pZLR4)
|
Identification assay: | HPLC-HR-MS
|
Application: | virulence factors synthesis for plant-bacterial interaction
|
Features of bacteria: | aetiological agent responsible for enteric red mouth (ERM) disease
|
Reference: | 17241341 [Link to PubMed]
|