| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0281
|
| SigMol name: | N-(3-Oxododecanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC12-HSL |
| IUPAC name: | 3-oxo-N-(2-oxooxolan-3-yl)dodecanamide |
| SMILES: | CCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
| Molecular Formula: | C16H27NO4 |
| Molecular Weight (g/mol): | 297.39 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-oxododecanoyl)-homoserine lactone
|
|
Synthase gene: | yruI
|
|
Recipient gene: | yruR
|
|
Organism: | Yersinia ruckeri [Link to taxonomy browser] |
|
Strain: | 89
|
|
Preliminary assay: | well-diffusion assay
|
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NT1 (pZLR4)
|
|
Identification assay: | HPLC-HR-MS
|
|
Application: | virulence factors synthesis for plant-bacterial interaction
|
|
Features of bacteria: | aetiological agent responsible for enteric red mouth (ERM) disease
|
|
Reference: | 17241341 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.