| |
---|
Chemical Information |
QSSM_ID: | QSSM_0272
|
SigMol name: | N-(3-Oxododecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC12-HSL |
IUPAC name: | 3-oxo-N-(2-oxooxolan-3-yl)dodecanamide |
SMILES: | CCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C16H27NO4 |
Molecular Weight (g/mol): | 297.39 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-(3-oxododecanoyl)-homoserine lactone
|
Synthase gene: | yruI
|
Recipient gene: | yruR
|
Organism: | Yersinia ruckeri [Link to taxonomy browser] |
Strain: | NCIMB 1316
|
Preliminary assay: | well-diffusion assay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NT1 (pZLR4)
|
Identification assay: | HPLC-HR-MS
|
Application: | virulence factors synthesis for plant-bacterial interaction
|
Features of bacteria: | aetiological agent responsible for enteric red mouth (ERM) disease
|
Reference: | 17241341 [Link to PubMed]
|