| |
---|
Chemical Information |
QSSM_ID: | QSSM_0239
|
SigMol name: | N-(3-Oxododecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC12-HSL |
IUPAC name: | 3-oxo-N-(2-oxooxolan-3-yl)dodecanamide |
SMILES: | CCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C16H27NO4 |
Molecular Weight (g/mol): | 297.39 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 3-oxo-N-(tetrahydro-2-oxo-3-furanyl)dodecanamide [or N-(3-oxododecanoyl)homoserine lactone]
|
Synthase gene: | lasI
|
Recipient gene: | lasR
|
Organism: | Pseudomonas aeruginosa [Link to taxonomy browser] |
Strain: | PAO1
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Escherichia coli MG4 (pKDT17)
|
Identification assay: | CI-MS
|
Application: | virulence
|
Features of bacteria: | opportunistic human pathogen
|
Reference: | 8278364 [Link to PubMed]
|