| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0234
|
| SigMol name: | N-Tetradec-2,7-dienoyl-L-homoserine lactone [Link]
|
| Abbreviation: | C14:2-HSL |
| IUPAC name: | (2E,7E)-N-(2-Oxotetrahydro-3-furanyl)-2,7-tetradecadienamide |
| SMILES: | CCCCCC\C=C\CCC\C=C\C(=O)NC1CCOC1=O |
| Molecular Formula: | C18H29NO3 |
| Molecular Weight (g/mol): | 307.43 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | C14:2-HSL
|
|
Synthase gene: | mlaI
|
|
Recipient gene: | mlaR
|
|
Organism: | Methylobacterium extorquens [Link to taxonomy browser] |
|
Strain: | AM1
|
|
Preliminary assay: | Plate assay
|
|
Bacterial strain used in Preliminary assay: | Pseudomonas putida F117 (pKR-C12)
|
|
Identification assay: | ESI-MS,NMR
|
|
Application: | Not Specified
|
|
Features of bacteria: | pink-pigmented facultative methylotrophic bacteria
|
|
Reference: | 16412429 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.