| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0185
|
| SigMol name: | N-(3-Oxooctanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC8-HSL |
| IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]octanamide |
| SMILES: | CCCCCC(=O)CC(=O)NC1CCOC1=O |
| Molecular Formula: | C12H19NO4 |
| Molecular Weight (g/mol): | 241.28 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-oxo-octanoyl)-L-homoserine lactone
|
|
Synthase gene: | traI
|
|
Recipient gene: | traR
|
|
Organism: | Agrobacterium tumefaciens [Link to taxonomy browser] |
|
Strain: | NTL4
|
|
Preliminary assay: | Reporter bioassay
|
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL4 (pZLR4)
|
|
Identification assay: | Far Western analysis
|
|
Application: | Conjugative transfer of the Ti plasmids
|
|
Features of bacteria: | reponsible for crown gall tumors in plant
|
|
Reference: | 18203831 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.