| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0167
|
| SigMol name: | N-(3-Hydroxydecanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OHC10-HSL |
| IUPAC name: | 3-Hydroxy-N-(2-oxotetrahydro-3-furanyl)decanamide |
| SMILES: | O=C1OCCC1NC(=O)CC(O)CCCCCCC |
| Molecular Formula: | C14H25NO4 |
| Molecular Weight (g/mol): | 271.35 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-hydroxydecanoyl)-L-homoserine lactone
|
|
Synthase gene: | braI
|
|
Recipient gene: | braR
|
|
Organism: | Burkholderia xenovorans [Link to taxonomy browser] |
|
Strain: | LB400BRAI
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciensNT1(pDCI41E33)
|
|
Identification assay: | LC-ESI-MS/MS
|
|
Application: | Exopolysaccharides (EPS) production,Plant endophytic colonization
|
|
Features of bacteria: | bacteria having symbiotic N2 fixation with mosses and higher plant and member of betaproteobacteria
|
|
Reference: | 23686262 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.