| |
---|
Chemical Information |
QSSM_ID: | QSSM_0116
|
SigMol name: | N-(3-Oxodecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC10-HSL |
IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]decanamide |
SMILES: | CCCCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C14H23NO4 |
Molecular Weight (g/mol): | 269.34 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 3-oxo-C10-HSL
|
Synthase gene: | braIUNA
|
Recipient gene: | braRUNA
|
Organism: | Burkholderia unamae [Link to taxonomy browser] |
Strain: | MTl-641T
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Pseudomonas putida F117(pKRC12)
|
Identification assay: | TLC
|
Application: | Phenol degradation, EPS production, biofilm formation
|
Features of bacteria: | member of Burkholderia cepacia complex (BCC)
|
Reference: | 20435760 [Link to PubMed]
|