| |
---|
Chemical Information |
QSSM_ID: | QSSM_0113
|
SigMol name: | N-(3-Hydroxydecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OHC10-HSL |
IUPAC name: | 3-Hydroxy-N-(2-oxotetrahydro-3-furanyl)decanamide |
SMILES: | O=C1OCCC1NC(=O)CC(O)CCCCCCC |
Molecular Formula: | C14H25NO4 |
Molecular Weight (g/mol): | 271.35 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-(3-hydroxydecanoyl)-L-homoserine lactone
|
Synthase gene: | cviI
|
Recipient gene: | cviR
|
Organism: | Chromobacterium violaceum [Link to taxonomy browser] |
Strain: | ATCC 12472
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL4 (pZLR4)
|
Identification assay: | MALDI-MS
|
Application: | violacein production
|
Features of bacteria: | gram-negative bacteria commonly found in soil and water
|
Reference: | 18177311 [Link to PubMed]
|