| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0094
|
| SigMol name: | N-(3-Hydroxydodecanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OHC12-HSL |
| IUPAC name: | 3-Hydroxy-N-[(3S)-2-oxotetrahydro-3-furanyl]dodecanamide |
| SMILES: | CCCCCCCCCC(CC(=O)N[C@H]1CCOC1=O)O |
| Molecular Formula: | C16H29NO4 |
| Molecular Weight (g/mol): | 299.41 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-3-hydroxy- dodecanoyl-homoserine lactone
|
|
Synthase gene: | cmrI
|
|
Recipient gene: | cmrR
|
|
Organism: | Pseudomonas sp [Link to taxonomy browser] |
|
Strain: | CMR12a
|
|
Preliminary assay: | AHL bioassay (T-streaks)
|
|
Bacterial strain used in Preliminary assay: | Escherichia coli MH155 [pMHLAS]
|
|
Identification assay: | LC-MS/MS
|
|
Application: | phenazine and biosurfactant production
|
|
Features of bacteria: | root-colonizing rhizosphere pseudomonads
|
|
Reference: | 21071496 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.