| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0041
|
| SigMol name: | N-(3-Hydroxydodecanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OHC12-HSL |
| IUPAC name: | 3-Hydroxy-N-[(3S)-2-oxotetrahydro-3-furanyl]dodecanamide |
| SMILES: | CCCCCCCCCC(CC(=O)N[C@H]1CCOC1=O)O |
| Molecular Formula: | C16H29NO4 |
| Molecular Weight (g/mol): | 299.21 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-hydroxydodecanoyl)-L- homoserine lactone (OH-dDHL)
|
|
Synthase gene: | abaI
|
|
Recipient gene: | abaR
|
|
Organism: | Acinetobacter baumannii [Link to taxonomy browser] |
|
Strain: | M2
|
|
Preliminary assay: | beta-galactosidase assay
|
|
Bacterial strain used in Preliminary assay: | Acinetobacter baumannii M2 abaI::lacZ
|
|
Identification assay: | Not Specified
|
|
Application: | biofilm formation, surface motility
|
|
Features of bacteria: | pan-drug resistant pathogen
|
|
Reference: | 22853441 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.