| |
---|
Chemical Information |
QSSM_ID: | QSSM_0014
|
SigMol name: | N-(3-Oxododecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC12-HSL |
IUPAC name: | 3-oxo-N-(2-oxooxolan-3-yl)dodecanamide |
SMILES: | CCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C16H27NO4 |
Molecular Weight (g/mol): | 297.39 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-(3- oxododecanoyl)-L-homoserine lactone
|
Synthase gene: | lasI
|
Recipient gene: | lasR
|
Organism: | Pseudomonas aeruginosa [Link to taxonomy browser] |
Strain: | PAO1
|
Preliminary assay: | cross-feeding bioassay
|
Bacterial strain used in Preliminary assay: | Cross-feeding bioassay {Chromobacterium violaceum CV026; Chromobacterium violaceum VIR07}
|
Identification assay: | Not Specified
|
Application: | production of several virulence factors(elastase, rhamnolipid), biofilm formation
|
Features of bacteria: | opportunistic pathogen
|
Reference: | 22706193 [Link to PubMed]
|