| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0005
|
| SigMol name: | N-Tetradec-7-enoyl-L-homoserine lactone [Link]
|
| Abbreviation: | C14:1-HSL |
| IUPAC name: | (7E)-N-(2-oxooxolan-3-yl)tetradec-7-enamide |
| SMILES: | CCCCCC\C=C\CCCCCC(=O)NC1CCOC1=O |
| Molecular Formula: | C18H31NO3 |
| Molecular Weight (g/mol): | 309.44 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-[(Z)-tetradec-9-enoyl]homoserine lactone
|
|
Synthase gene: | luxI homologue
|
|
Recipient gene: | luxR homologue
|
|
Organism: | Roseovarius tolerans [Link to taxonomy browser] |
|
Strain: | EL 164
|
|
Preliminary assay: | Not Specified
|
|
Bacterial strain used in Preliminary assay: | Pseudomonas putida pKR-C12
|
|
Identification assay: | GC-MS
|
|
Application: | chemical communication
|
|
Features of bacteria: | marine bacterium
|
|
Reference: | 24078590 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.