| HSPMdb Accession No | HSPMDB001427 |
| PMID | 25935385 |
| Target | Hsp70 |
| HSP Name | Hsp70 |
| Organism | Human |
| Localization | Cytosol |
| Enzymatic activity | Binding affinity |
| Compound Name | 35 |
| IUPAC Name | N-(4-fluorobenzyl)-N-methyl-1-(2-(methylthio)pyrimidin-4-yl)piperidin-4-amine |
| SMILES | CSc1nccc(n1)N2CCC(CC2)N(C)Cc3ccc(F)cc3 |
| Class | Piperidine derivative |
| Kd (µM) | 2.045 |
| Site of Interaction | Nucleotide binding domain (allosteric site) |
| Type of Enzymatic Assay | Surface plasmon resonance (SPR) |
| Disease | Cancer |
Loading Please Wait ...