| HSPMdb Accession No | HSPMDB001393 |
| PMID | 25935385 |
| Target | Hsp70 |
| HSP Name | Hsc70 (HSPA8) and Hsp72 (HSPA1A) |
| Organism | Human |
| Localization | Cytosol and nucleus |
| Cellular activity | Antiproliferative activity |
| Compound Name | 37 |
| IUPAC Name | N-(2-chloro-6-fluorobenzyl)-N-methyl-1-(2-(methylthio)pyrimidin-4-yl)piperidin-4-amine |
| SMILES | CSc1nccc(n1)N2CCC(CC2)N(C)Cc3c(F)cccc3Cl |
| Class | Piperidine derivative |
| Site of Interaction | Nucleotide binding domain (allosteric site) |
| Percentage Cell Growth Inhibition | 84.2 at 5 uM |
| Cellular assay | Luminescence based viability assay |
| Cellular Model | MDA-MB-453 |
| Disease | Cancer |
Loading Please Wait ...