| HSPMdb Accession No | HSPMDB001015 |
| PMID | 25148104 |
| Target | Hsp70 |
| HSP Name | DnaK |
| Organism | Bacteria |
| Localization | Cytosol and membrane |
| Enzymatic activity | Binding affinity |
| Compound Name | PET-16 |
| IUPAC Name | triphenyl(phenylethynyl)phosphonium bromide |
| SMILES | [Br-].C1(=CC=CC=C1)[P+](C#CC1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Class | 2-phenylethyenesulfonamide (PES) derivative |
| Kd (µM) | 6 |
| Site of Interaction | C-terminal domain |
| Type of Enzymatic Assay | Isothermal Titration Calorimetry (ITC) |
| Disease | Bacterial infection |
Loading Please Wait ...