| HSPMdb Accession No | HSPMDB001013 |
| PMID | 25148104 |
| Target | Hsp70 |
| HSP Name | Hsp72 (HSPA1A) |
| Organism | Human |
| Localization | Cytosol and nucleus |
| Enzymatic activity | Binding affinity |
| Compound Name | PET-16 |
| IUPAC Name | triphenyl(phenylethynyl)phosphonium bromide |
| SMILES | [Br-].C1(=CC=CC=C1)[P+](C#CC1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Class | 2-phenylethyenesulfonamide (PES) derivative |
| Kd (µM) | 3.8 |
| Site of Interaction | C-terminal domain |
| Type of Enzymatic Assay | Isothermal Titration Calorimetry (ITC) |
| Disease | Cancer |
Loading Please Wait ...