| HSPMdb Accession No | HSPMDB000690 |
| PMID | 29953808 |
| Target | Hsp70 |
| HSP Name | Hsc70 (HSPA8) and Hsp72 (HSPA1A) |
| Organism | Human |
| Localization | Cytosol and nucleus |
| Cellular activity | Antiproliferative activity |
| Compound Name | 21 |
| IUPAC Name | 2-((Z)-((E)-5-(6-chloro-3-methylbenzo[d]thiazol-2(3H)-ylidene)-3-ethyl-4-oxothiazolidin-2-ylidene)methyl)-3-(4-fluorobenzyl)thiazol-3-ium chloride |
| SMILES | [Cl-].CCN\1C(=O)/C(SC1=C\c2scc[n+]2Cc3ccc(F)cc3)=C/4Sc5cc(Cl)ccc5N4C |
| Class | Benzothiazole Rhodacyanines derivative |
| EC50 (µM) | 0.61 |
| Site of Interaction | Nucleotide binding domain (allosteric site) |
| Cellular assay | MTT viability assay |
| Cellular Model | MCF7 |
| Disease | Cancer |
Loading Please Wait ...