| HSPMdb Accession No | HSPMDB000613 |
| PMID | 19694756 |
| Target | Hsp70 |
| HSP Name | DnaK |
| Organism | Bacteria |
| Localization | Cytosol and membrane |
| Enzymatic activity | Binding affinity |
| Compound Name | B4 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5-methylfuran-2-carboxamide |
| SMILES | CC1=CC=C(O1)C(=O)NCC1=CC=C(Cl)C=C1 |
| Class | Chem Bridge, MayBridge, Life Chemicals and MicroSource, Gaylordsville, CT, USA |
| Kd (µM) | 19.3 |
| Site of Interaction | C-terminal domain |
| Type of Enzymatic Assay | Isothermal Titration Calorimetry (ITC) |
| Disease | Bacterial infection |
Loading Please Wait ...