| HSPMdb Accession No | HSPMDB000579 |
| PMID | 19195901 |
| Target | Hsp70 |
| HSP Name | PfHsp70 |
| Organism | Plasmodium falciparum |
| Localization | Cytosol and nucleus |
| Cellular activity | Antiparasitic activity (inhibition of [3H]hypoxanthine uptake) |
| Compound Name | MAL2-213 |
| IUPAC Name | ethyl 1-[3-({2-[3-(methoxycarbonyl)-2-methyl-5-phenyl-1H-pyrrol-1-yl]ethyl}carbamoyl)propyl]-6-methyl-4-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(CCCC(=O)NCCN2C(C)=C(C=C2C2=CC=CC=C2)C(=O)OC)C(=O)NC1C1=CC=C(C=C1)[N+]([O-])=O |
| Class | Pyrimidinone amide |
| IC50 (µM) | 0.03 |
| Cellular assay | [3H]hypoxanthine uptake assay |
| Cellular Model | P. falciparum |
| Disease | Malaria |
Loading Please Wait ...