| HSPMdb Accession No | HSPMDB000514 |
| PMID | 23472668 |
| Target | Hsp70 |
| HSP Name | Hsc70 (HSPA8) |
| Organism | Human |
| Localization | Cytosol and nucleus |
| Enzymatic activity | Binding affinity |
| Compound Name | YM-03 |
| IUPAC Name | 3-ethyl-5-[(2E)-3-methyl-2,3-dihydro-1,3-benzothiazol-2-ylidene]-2-(methylsulfanyl)-4-oxo-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | CC[N+]1=C(SC)S\C(C1=O)=C1\SC2=C(C=CC=C2)N1C |
| Class | Rhodacyanine derivative |
| IC50 (µM) | >50 |
| Site of Interaction | Nucleotide binding domain (allosteric site) |
| Type of Enzymatic Assay | Enzyme-linked immunosorbent assay (ELISA) |
| Disease | Alzheimers disease |
Loading Please Wait ...