| HSPMdb Accession No | HSPMDB000496 |
| PMID | 28455613 |
| Target | Hsp70 |
| HSP Name | PfHsp70-1 |
| Organism | Plasmodium falciparum |
| Localization | Cytosol and nucleus |
| Enzymatic activity | Inhibition of ATPase activity |
| Compound Name | Polymixin B |
| IUPAC Name | N-[4-amino-1-[[1-[[4-amino-1-oxo-1-[[6,9,18-tris(2-aminoethyl)-15-benzyl-3-(1-hydroxyethyl)-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]-6-methyloctanamide |
| SMILES | CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(CC(C)C)NC(=O)C(Cc2ccccc2)NC(=O)C(CCN)NC1=O)C(C)O |
| Class | Lipopeptide anrtibiotic |
| % Enzymatic Inhibition/Fold Change | 100% at 25 uM |
| Kd (µM) | 0.38 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | ATPase assay |
| Disease | Malaria |
Loading Please Wait ...