| HSPMdb Accession No | HSPMDB000445 |
| PMID | 19256508 |
| Target | Hsp70 |
| HSP Name | Hsc70 |
| Organism | Human |
| Localization | Cytosol |
| Enzymatic activity | Inhibition of ATP binding |
| Compound Name | 8 |
| IUPAC Name | (2R,3R,4S,5R)-2-{6-Amino-8-[(benzo[1,3]dioxol-5-ylmethyl)-amino]-purin-9-yl}-5- hydroxymethyltetrahydrofuran-3,4-diol |
| SMILES | Nc1ncnc2n([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c(NCc4ccc5OCOc5c4)nc12 |
| Class | Adenosine derivative |
| IC50 (µM) | 4.9 |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | Fluorescence polarization (FP) assay |
Loading Please Wait ...