| HSPMdb Accession No | HSPMDB000202 |
| PMID | 15448148 |
| Target | Hsp70 |
| HSP Name | Ssa1p |
| Organism | Yeast |
| Localization | Cytosol |
| Enzymatic activity | Activation of ATPase activity (endogenous) |
| Compound Name | MAL3-101 |
| IUPAC Name | Benzyl 4-([1,1?-biphenyl]-4-yl)-1-(6-((2-(butylamino)-1-(4-(2-methoxy-2-oxoethoxy)-3-(methoxycarbonyl)phenyl)-2-oxoethyl)(hexyl)amino)-6-oxohexyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| SMILES | O=C(C1=C(C)N(CCCCCC(N(C(C2=CC=C(OCC(OC)=O)C(C(OC)=O)=C2)C(NCCCC)=O)CCCCCC)=O)C(NC1C3=CC=C(C4=CC=CC=C4)C=C3)=O)OCC5=CC=CC=C5 |
| Class | Dihydropyrimidine derivative |
| % Enzymatic Inhibition/Fold Change | Fold change 1.2 (at 0.6 mM) |
| Site of Interaction | Interface between Hsp70 and Hsp40 |
| Type of Enzymatic Assay | ATPase assay |
Loading Please Wait ...