| HSPMdb Accession No | HSPMDB000106 |
| PMID | 29414793 |
| Target | Hsp70 |
| HSP Name | Hsp72/DnaJ2/BAG2 |
| Organism | Human |
| Localization | Cytosol and nucleus |
| Enzymatic activity | Inhibition of ATPase activity (protein-protein interaction) |
| Compound Name | IT2-179 |
| IUPAC Name | N-(2,5-dibromophenyl)-4-{2-methylimidazo[1,2-a]pyridin-3-yl}-1,3-thiazol-2-amine |
| SMILES | CC1=C(N2C=CC=CC2=N1)C1=CSC(NC2=CC(Br)=CC=C2Br)=N1 |
| Class | 2-aminothiazoles derivative |
| EC50 (µM) | 3.6 |
| Site of Interaction | Nucleotide binding domain (allosteric site) |
| Type of Enzymatic Assay | ATPase assay |
Loading Please Wait ...