| HSPMdb Accession No | HSPMDB000075 |
| PMID | 27155465 |
| Target | Hsp70 |
| HSP Name | Hsp70-2 |
| Organism | Human |
| Localization | Cytosol and cytoskeleton |
| Cellular activity | Antiproliferative activity |
| Compound Name | 387 |
| IUPAC Name | N-(3,3-dimethyl-1-(3-phenylthioureido)butyl)cinnamamide |
| SMILES | CC(C)(C)CC(NC(=O)C=Cc1ccccc1)NC(=S)Nc2ccccc2 |
| Class | N,N'-disubstituted thiourea derivative |
| Site of Interaction | Nucleotide binding domain |
| Percentage Cell Growth Inhibition | 34.6 at 10 uM |
| Cellular assay | Luminescence based viability assay |
| Cellular Model | BT/LapR1.0 |
| Disease | Cancer |
Loading Please Wait ...