| HSPMdb Accession No | HSPMDB000021 |
| PMID | 27155465 |
| Target | Hsp70 |
| HSP Name | DnaK/DnaJ |
| Organism | Bacteria |
| Localization | Cytosol and membrane |
| Enzymatic activity | Inhibition of ATPase activity |
| Compound Name | 392 |
| IUPAC Name | (E)-N-(2,2-dimethyl-1-(3-o-tolylthioureido)propyl)-3-(3,4,5-trimethoxyphenyl)acrylamide |
| SMILES | COc1cc(/C=C/C(=O)NC(NC(=S)Nc2ccccc2C)C(C)(C)C)cc(OC)c1OC |
| Class | N,N'-disubstituted thiourea derivative |
| % Enzymatic Inhibition/Fold Change | 50.5% (at 200 uM) |
| Site of Interaction | Nucleotide binding domain |
| Type of Enzymatic Assay | ATPase assay |
Loading Please Wait ...